CAS 1794754-24-7 is the registry number for alpha-Methylaminovalerophenone-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg.
1-phenyl-2-(trideuteriomethylamino)pentan-1-one;hydrochloride (CAS 1794754-24-7) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 230.75 g/mol. IUPAC name: 1-phenyl-2-(trideuteriomethylamino)pentan-1-one;hydrochloride. InChIKey: MACVVBRQAPNUKT-MUTAZJQDSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 230.75 g/mol |
| IUPAC name | 1-phenyl-2-(trideuteriomethylamino)pentan-1-one;hydrochloride |
| InChIKey | MACVVBRQAPNUKT-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(CCC)C(=O)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)