Products 1794759-12-8
CAS 1794759-12-8 appears in our catalog under these names: N-Desmethyl Diphenhydramine-d3 Hydrochloride, >95% (HPLC), N-Desmethyl diphenhydramine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
2-benzhydryloxy-N-(trideuteriomethyl)ethanamine;hydrochloride (CAS 1794759-12-8) is a chemical compound with the molecular formula C16H20ClNO and a molecular weight of 280.81 g/mol. IUPAC name: 2-benzhydryloxy-N-(trideuteriomethyl)ethanamine;hydrochloride. InChIKey: OARUOQLHKTZEIM-NIIDSAIPSA-N.
| Molecular formula | C16H20ClNO |
|---|---|
| Molecular weight | 280.81 g/mol |
| IUPAC name | 2-benzhydryloxy-N-(trideuteriomethyl)ethanamine;hydrochloride |
| InChIKey | OARUOQLHKTZEIM-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)