CAS 1794791-19-7 is the registry number for 5-Nitro-1H-imidazole-1-ethanol-d4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1,1,2,2-tetradeuterio-2-(5-nitroimidazol-1-yl)ethanol (CAS 1794791-19-7) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 161.15 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(5-nitroimidazol-1-yl)ethanol. InChIKey: DFMZECOLZRIPOT-LNLMKGTHSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 161.15 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(5-nitroimidazol-1-yl)ethanol |
| InChIKey | DFMZECOLZRIPOT-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N1C=NC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)