CAS 1794811-72-5 is the registry number for Tolazamide-d7, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1-(azepan-1-yl)-3-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]sulfonylurea (CAS 1794811-72-5) is a chemical compound with the molecular formula C14H21N3O3S and a molecular weight of 318.45 g/mol. IUPAC name: 1-(azepan-1-yl)-3-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]sulfonylurea. InChIKey: OUDSBRTVNLOZBN-DMONGCNRSA-N.
| Molecular formula | C14H21N3O3S |
|---|---|
| Molecular weight | 318.45 g/mol |
| IUPAC name | 1-(azepan-1-yl)-3-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]sulfonylurea |
| InChIKey | OUDSBRTVNLOZBN-DMONGCNRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])S(=O)(=O)NC(=O)NN2CCCCCC2)[2H] |
Computed by PubChem (NCBI)