CAS 328106-72-5 is the registry number for 5-(Morpholine-4-sulfonyl)-2-pyrrolidin-1-yl-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylaniline (CAS 328106-72-5) is a chemical compound with the molecular formula C14H21N3O3S and a molecular weight of 311.40 g/mol. IUPAC name: 5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylaniline. InChIKey: AVXOENYLRRSKPG-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O3S |
|---|---|
| Molecular weight | 311.40 g/mol |
| IUPAC name | 5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylaniline |
| InChIKey | AVXOENYLRRSKPG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2)S(=O)(=O)N3CCOCC3)N |
Computed by PubChem (NCBI)