CAS 894356-80-0 is the registry number for Toluene-4-sulfonic acid 7-azido-heptyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-azidoheptyl 4-methylbenzenesulfonate (CAS 894356-80-0) is a chemical compound with the molecular formula C14H21N3O3S and a molecular weight of 311.40 g/mol. IUPAC name: 7-azidoheptyl 4-methylbenzenesulfonate. InChIKey: IFKZMKXZGOMMTN-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O3S |
|---|---|
| Molecular weight | 311.40 g/mol |
| IUPAC name | 7-azidoheptyl 4-methylbenzenesulfonate |
| InChIKey | IFKZMKXZGOMMTN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)