Products 1794828-46-8

CAS 1794828-46-8 is the registry number for 3-(3-Hydroxy-4-methoxyphenyl)propionic-d3 Acid (Dihydroisoferulic Acid). Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]propanoic acid (CAS 1794828-46-8) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 199.22 g/mol. IUPAC name: 3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]propanoic acid. InChIKey: ZVIJTQFTLXXGJA-FIBGUPNXSA-N.

Identity
Molecular formulaC10H12O4
Molecular weight199.22 g/mol
IUPAC name3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]propanoic acid
InChIKeyZVIJTQFTLXXGJA-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])OC1=C(C=C(C=C1)CCC(=O)O)O

Computed by PubChem (NCBI)