CAS 1794828-46-8 is the registry number for 3-(3-Hydroxy-4-methoxyphenyl)propionic-d3 Acid (Dihydroisoferulic Acid). Offered by: TRC. Available pack sizes: 50mg, 5mg.
3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]propanoic acid (CAS 1794828-46-8) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 199.22 g/mol. IUPAC name: 3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]propanoic acid. InChIKey: ZVIJTQFTLXXGJA-FIBGUPNXSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 199.22 g/mol |
| IUPAC name | 3-[3-hydroxy-4-(trideuteriomethoxy)phenyl]propanoic acid |
| InChIKey | ZVIJTQFTLXXGJA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)CCC(=O)O)O |
Computed by PubChem (NCBI)