Products 1794897-91-8
CAS 1794897-91-8 appears in our catalog under these names: 4'-Hydroxy Pyrimethanil-d4, >95% (HPLC), 4'-Hydroxy pyrimethanil-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2,3,5,6-tetradeuterio-4-[(4,6-dimethylpyrimidin-2-yl)amino]phenol (CAS 1794897-91-8) is a chemical compound with the molecular formula C12H13N3O and a molecular weight of 219.28 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[(4,6-dimethylpyrimidin-2-yl)amino]phenol. InChIKey: NUWWAHKTVOVTNC-LNFUJOGGSA-N.
| Molecular formula | C12H13N3O |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[(4,6-dimethylpyrimidin-2-yl)amino]phenol |
| InChIKey | NUWWAHKTVOVTNC-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC2=NC(=CC(=N2)C)C)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)