Products 1794977-34-6
CAS 1794977-34-6 appears in our catalog under these names: 2-Amino-1-(4-methylphenyl)ethanone-d3 Hydrochloride, 2–Amino–1–(4–methylphenyl)ethanone–d3 Hydrochloride, 2-Amino-1-(p-tolyl)ethan-1-one hydrochloride-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
2-amino-1-[4-(trideuteriomethyl)phenyl]ethanone;hydrochloride (CAS 1794977-34-6) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 188.67 g/mol. IUPAC name: 2-amino-1-[4-(trideuteriomethyl)phenyl]ethanone;hydrochloride. InChIKey: IHWOUORJQZGRRF-NIIDSAIPSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 188.67 g/mol |
| IUPAC name | 2-amino-1-[4-(trideuteriomethyl)phenyl]ethanone;hydrochloride |
| InChIKey | IHWOUORJQZGRRF-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)C(=O)CN.Cl |
Computed by PubChem (NCBI)