Products 1794979-13-7
CAS 1794979-13-7 is the registry number for Ortetamine-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
1-[2-(trideuteriomethyl)phenyl]propan-2-amine;hydrochloride (CAS 1794979-13-7) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 188.71 g/mol. IUPAC name: 1-[2-(trideuteriomethyl)phenyl]propan-2-amine;hydrochloride. InChIKey: PIJNEJGPRPNSAE-NIIDSAIPSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 188.71 g/mol |
| IUPAC name | 1-[2-(trideuteriomethyl)phenyl]propan-2-amine;hydrochloride |
| InChIKey | PIJNEJGPRPNSAE-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=CC=C1CC(C)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Ortetamine-d3 Hydrochloride