CAS 1795021-09-8 is the registry number for Tetrazepam-13C,d3. Offered by: TRC. Available pack sizes: 100mg.
7-chloro-5-(cyclohexen-1-yl)-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one (CAS 1795021-09-8) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 292.78 g/mol. IUPAC name: 7-chloro-5-(cyclohexen-1-yl)-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one. InChIKey: IQWYAQCHYZHJOS-KQORAOOSSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 292.78 g/mol |
| IUPAC name | 7-chloro-5-(cyclohexen-1-yl)-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | IQWYAQCHYZHJOS-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CCCCC3 |
Computed by PubChem (NCBI)