Products 92260-82-7
CAS 92260-82-7 appears in our catalog under these names: Zilpaterol Impurity 3, 4,5-Dihydro-6-oxime-imidazo(4,5,1-jk)(1)benzazepine-2,6,7(1H)-trione. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(10Z)-10-hydroxyimino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione (CAS 92260-82-7) is a chemical compound with the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. IUPAC name: (10Z)-10-hydroxyimino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione. InChIKey: YRFMUFXBAIBWKI-JYRVWZFOSA-N.
| Molecular formula | C11H9N3O3 |
|---|---|
| Molecular weight | 231.21 g/mol |
| IUPAC name | (10Z)-10-hydroxyimino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione |
| InChIKey | YRFMUFXBAIBWKI-JYRVWZFOSA-N |
| SMILES | C\1CN2C3=C(C=CC=C3NC2=O)C(=O)/C1=N\O |
Computed by PubChem (NCBI)