CAS 1795373-41-9 is the registry number for 2-Amino-6-(((1-(aminocarbonyl)-3-carboxypropyl)amino)carbonyl)-benzoic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-amino-6-[(1-amino-4-carboxy-1-oxobutan-2-yl)carbamoyl]benzoic acid (CAS 1795373-41-9) is a chemical compound with the molecular formula C13H15N3O6 and a molecular weight of 309.27 g/mol. IUPAC name: 2-amino-6-[(1-amino-4-carboxy-1-oxobutan-2-yl)carbamoyl]benzoic acid. InChIKey: FTSFFLLHKYVSIW-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O6 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | 2-amino-6-[(1-amino-4-carboxy-1-oxobutan-2-yl)carbamoyl]benzoic acid |
| InChIKey | FTSFFLLHKYVSIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)C(=O)O)C(=O)NC(CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)