CAS 67607-48-1 is the registry number for Fa-gly-abu-nh2, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-[carbamoyl-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]propanoic acid (CAS 67607-48-1) is a chemical compound with the molecular formula C13H15N3O6 and a molecular weight of 309.27 g/mol. IUPAC name: 3-[carbamoyl-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]propanoic acid. InChIKey: BCFHWCIKUREZJQ-ONEGZZNKSA-N.
| Molecular formula | C13H15N3O6 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | 3-[carbamoyl-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]propanoic acid |
| InChIKey | BCFHWCIKUREZJQ-ONEGZZNKSA-N |
| SMILES | C1=COC(=C1)/C=C/C(=O)NCC(=O)N(CCC(=O)O)C(=O)N |
Computed by PubChem (NCBI)