Products 41149-11-5
CAS 41149-11-5 appears in our catalog under these names: Ac-Glu-pNA, Ac–Glu–pNA. Offered by: Creative Peptides, GLPBio. Available pack sizes: 50mg, 250mg.
(4S)-4-acetamido-5-(4-nitroanilino)-5-oxopentanoic acid (CAS 41149-11-5) is a chemical compound with the molecular formula C13H15N3O6 and a molecular weight of 309.27 g/mol. IUPAC name: (4S)-4-acetamido-5-(4-nitroanilino)-5-oxopentanoic acid. InChIKey: SDTVKGSMFQVLAM-NSHDSACASA-N.
| Molecular formula | C13H15N3O6 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | (4S)-4-acetamido-5-(4-nitroanilino)-5-oxopentanoic acid |
| InChIKey | SDTVKGSMFQVLAM-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)