Products 1795515-49-9
CAS 1795515-49-9 is the registry number for 8-(aminomethyl)pentacyclo(5.4.0.02,6.03,10.05,9)undecan-8-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-(aminomethyl)pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol;hydrochloride (CAS 1795515-49-9) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 8-(aminomethyl)pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol;hydrochloride. InChIKey: XJVUQNHIHBXOOU-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 8-(aminomethyl)pentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-ol;hydrochloride |
| InChIKey | XJVUQNHIHBXOOU-UHFFFAOYSA-N |
| SMILES | C1C2C3CC4C2C5C1C3C(C45)(CN)O.Cl |
Computed by PubChem (NCBI)