CAS 1795785-63-5 is the registry number for N-Methyl-L-DOPA-d3. Offered by: TRC. Available pack sizes: 25mg.
(2S)-3-(3,4-dihydroxyphenyl)-2-(trideuteriomethylamino)propanoic acid (CAS 1795785-63-5) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 214.23 g/mol. IUPAC name: (2S)-3-(3,4-dihydroxyphenyl)-2-(trideuteriomethylamino)propanoic acid. InChIKey: QZIWDCLHLOADPK-LNEZGBMJSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | (2S)-3-(3,4-dihydroxyphenyl)-2-(trideuteriomethylamino)propanoic acid |
| InChIKey | QZIWDCLHLOADPK-LNEZGBMJSA-N |
| SMILES | [2H]C([2H])([2H])N[C@@H](CC1=CC(=C(C=C1)O)O)C(=O)O |
Computed by PubChem (NCBI)