CAS 1795787-05-1 appears in our catalog under these names: L–Cysteine–15N–d3, L-Cysteine-15N,d3, >95% (HPLC), L-Cysteine-d3,15N. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 1mg, 25mg, 10mg, 5mg, 1 mg.
(2R)-2-(15N)azanyl-2,3,3-trideuterio-3-sulfanylpropanoic acid (CAS 1795787-05-1) is a chemical compound with the molecular formula C3H7NO2S and a molecular weight of 125.17 g/mol. IUPAC name: (2R)-2-(15N)azanyl-2,3,3-trideuterio-3-sulfanylpropanoic acid. InChIKey: XUJNEKJLAYXESH-KIYJLCFFSA-N.
| Molecular formula | C3H7NO2S |
|---|---|
| Molecular weight | 125.17 g/mol |
| IUPAC name | (2R)-2-(15N)azanyl-2,3,3-trideuterio-3-sulfanylpropanoic acid |
| InChIKey | XUJNEKJLAYXESH-KIYJLCFFSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])S)[15NH2] |
Computed by PubChem (NCBI)