Products 204523-09-1
CAS 204523-09-1 appears in our catalog under these names: L-Cysteine-15N, >95% (HPLC), L–Cysteine–15N, L-CYSTEINE-15N, >=98 ATOM % 15N, >=98%, L-Cysteine-¹⁵N, 98%, 98%, L-Cysteine-15N, 98.7%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 100MG, 25mg, 25 mg, 10 mg, 5 mg.
(2R)-2-(15N)azanyl-3-sulfanylpropanoic acid (CAS 204523-09-1) is a chemical compound with the molecular formula C3H7NO2S and a molecular weight of 122.15 g/mol. IUPAC name: (2R)-2-(15N)azanyl-3-sulfanylpropanoic acid. InChIKey: XUJNEKJLAYXESH-GZPBOPPUSA-N.
| Molecular formula | C3H7NO2S |
|---|---|
| Molecular weight | 122.15 g/mol |
| IUPAC name | (2R)-2-(15N)azanyl-3-sulfanylpropanoic acid |
| InChIKey | XUJNEKJLAYXESH-GZPBOPPUSA-N |
| SMILES | C([C@@H](C(=O)O)[15NH2])S |
Computed by PubChem (NCBI)