Products 202114-66-7
CAS 202114-66-7 appears in our catalog under these names: L-Cysteine-13C3, >95% (HPLC), L–Cysteine–13C3, L-Cysteine-13C3, L-Cysteine-13C3, 99.90%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 1 mg, 5 mg, 10 mg.
(2R)-2-amino-3-sulfanyl(1,2,3-13C3)propanoic acid (CAS 202114-66-7) is a chemical compound with the molecular formula C3H7NO2S and a molecular weight of 124.14 g/mol. IUPAC name: (2R)-2-amino-3-sulfanyl(1,2,3-13C3)propanoic acid. InChIKey: XUJNEKJLAYXESH-GCCOVPGMSA-N.
| Molecular formula | C3H7NO2S |
|---|---|
| Molecular weight | 124.14 g/mol |
| IUPAC name | (2R)-2-amino-3-sulfanyl(1,2,3-13C3)propanoic acid |
| InChIKey | XUJNEKJLAYXESH-GCCOVPGMSA-N |
| SMILES | [13CH2]([13C@@H]([13C](=O)O)N)S |
Computed by PubChem (NCBI)