Products 1796-84-5
CAS 1796-84-5 appears in our catalog under these names: 4–Ethoxy–3–nitropyridine, 4-Ethoxy-3-nitro-pyridine, 4-Ethoxy-3-nitropyridine 97%, 4-Ethoxy-3-nitropyridine, 97%, 97%, 4-Ethoxy-3-nitropyridine, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 2g, 10g, 50g, 250mg, 1g, 100g.
4-ethoxy-3-nitropyridine (CAS 1796-84-5) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 4-ethoxy-3-nitropyridine. InChIKey: ABOSMHRLVUWEMT-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 4-ethoxy-3-nitropyridine |
| InChIKey | ABOSMHRLVUWEMT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=NC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)