CAS 1796558-59-2 is the registry number for 3-Chloro-5-(trifluoromethoxy)phenacyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-[3-chloro-5-(trifluoromethoxy)phenyl]ethanone (CAS 1796558-59-2) is a chemical compound with the molecular formula C9H5BrClF3O2 and a molecular weight of 317.48 g/mol. IUPAC name: 2-bromo-1-[3-chloro-5-(trifluoromethoxy)phenyl]ethanone. InChIKey: SETXUZFJAVNMAT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClF3O2 |
|---|---|
| Molecular weight | 317.48 g/mol |
| IUPAC name | 2-bromo-1-[3-chloro-5-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | SETXUZFJAVNMAT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)C(=O)CBr |
Computed by PubChem (NCBI)