CAS 3002512-37-7 is the registry number for 1-(6-bromo-2-fluoro-3-methoxyphenyl)-2-chloro-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-bromo-2-fluoro-3-methoxyphenyl)-2-chloro-2,2-difluoroethanone (CAS 3002512-37-7) is a chemical compound with the molecular formula C9H5BrClF3O2 and a molecular weight of 317.48 g/mol. IUPAC name: 1-(6-bromo-2-fluoro-3-methoxyphenyl)-2-chloro-2,2-difluoroethanone. InChIKey: HMYFQJJXTWPFMB-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClF3O2 |
|---|---|
| Molecular weight | 317.48 g/mol |
| IUPAC name | 1-(6-bromo-2-fluoro-3-methoxyphenyl)-2-chloro-2,2-difluoroethanone |
| InChIKey | HMYFQJJXTWPFMB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C(=O)C(F)(F)Cl)F |
Computed by PubChem (NCBI)