CAS 2167951-05-3 is the registry number for Methyl 4-bromo-2-chloro-5-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
Methyl 4-bromo-2-chloro-5-(trifluoromethyl)benzoate (CAS 2167951-05-3) is a chemical compound with the molecular formula C9H5BrClF3O2 and a molecular weight of 317.48 g/mol. IUPAC name: methyl 4-bromo-2-chloro-5-(trifluoromethyl)benzoate. InChIKey: NBZGJBLNUCDBMT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClF3O2 |
|---|---|
| Molecular weight | 317.48 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-5-(trifluoromethyl)benzoate |
| InChIKey | NBZGJBLNUCDBMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)