Products 1796585-39-1
CAS 1796585-39-1 is the registry number for tert-Butyl ((4S,5S)-2,5-dimethyl-3-oxohept-1-en-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(4S,5S)-2,5-dimethyl-3-oxohept-1-en-4-yl]carbamate (CAS 1796585-39-1) is a chemical compound with the molecular formula C14H25NO3 and a molecular weight of 255.35 g/mol. IUPAC name: tert-butyl N-[(4S,5S)-2,5-dimethyl-3-oxohept-1-en-4-yl]carbamate. InChIKey: YHYTTYPCQGQHLX-QWRGUYRKSA-N.
| Molecular formula | C14H25NO3 |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | tert-butyl N-[(4S,5S)-2,5-dimethyl-3-oxohept-1-en-4-yl]carbamate |
| InChIKey | YHYTTYPCQGQHLX-QWRGUYRKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)C(=C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)