CAS 1796894-91-1 appears in our catalog under these names: 2-[(Prop-2-yn-1-yl)amino]-2-(2,4,6-trimethylphenyl)acetic acid hydrochloride, 95%, 2-((Prop-2-yn-1-yl)amino)-2-(2,4,6-trimethylphenyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(prop-2-ynylamino)-2-(2,4,6-trimethylphenyl)acetic acid;hydrochloride (CAS 1796894-91-1) is a chemical compound with the molecular formula C14H18ClNO2 and a molecular weight of 267.75 g/mol. IUPAC name: 2-(prop-2-ynylamino)-2-(2,4,6-trimethylphenyl)acetic acid;hydrochloride. InChIKey: PSTVGBQJDSMKEO-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO2 |
|---|---|
| Molecular weight | 267.75 g/mol |
| IUPAC name | 2-(prop-2-ynylamino)-2-(2,4,6-trimethylphenyl)acetic acid;hydrochloride |
| InChIKey | PSTVGBQJDSMKEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C(=O)O)NCC#C)C.Cl |
Computed by PubChem (NCBI)