Products 454674-65-8
CAS 454674-65-8 is the registry number for tert-Butyl 3-(chloromethyl)indoline-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(chloromethyl)-2,3-dihydroindole-1-carboxylate (CAS 454674-65-8) is a chemical compound with the molecular formula C14H18ClNO2 and a molecular weight of 267.75 g/mol. IUPAC name: tert-butyl 3-(chloromethyl)-2,3-dihydroindole-1-carboxylate. InChIKey: MIQPPUKPQDMJQW-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO2 |
|---|---|
| Molecular weight | 267.75 g/mol |
| IUPAC name | tert-butyl 3-(chloromethyl)-2,3-dihydroindole-1-carboxylate |
| InChIKey | MIQPPUKPQDMJQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C2=CC=CC=C21)CCl |
Computed by PubChem (NCBI)