Products 440647-97-2

CAS 440647-97-2 is the registry number for 1-[(2-Chlorobenzyl)amino]cyclohexanecarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-[(2-chlorophenyl)methylamino]cyclohexane-1-carboxylic acid (CAS 440647-97-2) is a chemical compound with the molecular formula C14H18ClNO2 and a molecular weight of 267.75 g/mol. IUPAC name: 1-[(2-chlorophenyl)methylamino]cyclohexane-1-carboxylic acid. InChIKey: BGTLCSVQOWZGHB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18ClNO2
Molecular weight267.75 g/mol
IUPAC name1-[(2-chlorophenyl)methylamino]cyclohexane-1-carboxylic acid
InChIKeyBGTLCSVQOWZGHB-UHFFFAOYSA-N
SMILESC1CCC(CC1)(C(=O)O)NCC2=CC=CC=C2Cl

Computed by PubChem (NCBI)