CAS 1797023-70-1 is the registry number for (2-(Phenoxymethyl)-1,3-thiazol-4-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2-(phenoxymethyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (CAS 1797023-70-1) is a chemical compound with the molecular formula C11H13ClN2OS and a molecular weight of 256.75 g/mol. IUPAC name: [2-(phenoxymethyl)-1,3-thiazol-4-yl]methanamine;hydrochloride. InChIKey: WLWDLFQGGFCTIM-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2OS |
|---|---|
| Molecular weight | 256.75 g/mol |
| IUPAC name | [2-(phenoxymethyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| InChIKey | WLWDLFQGGFCTIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NC(=CS2)CN.Cl |
Computed by PubChem (NCBI)