CAS 877977-27-0 is the registry number for 2-(3-Chloropropyl)-5,6-dimethyl-3H,4H-thieno(2,3-d)pyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3-chloropropyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 877977-27-0) is a chemical compound with the molecular formula C11H13ClN2OS and a molecular weight of 256.75 g/mol. IUPAC name: 2-(3-chloropropyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: AUHXTNCNYNJJND-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2OS |
|---|---|
| Molecular weight | 256.75 g/mol |
| IUPAC name | 2-(3-chloropropyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | AUHXTNCNYNJJND-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)CCCCl)C |
Computed by PubChem (NCBI)