Products 2411635-80-6
CAS 2411635-80-6 appears in our catalog under these names: 2-(Aminomethyl)-5-(4-methylthiazol-5-yl)phenol hydrochloride, 98%, 98%, 2-(AMINOMETHYL)-5-(4-METHYLTHIAZOL-5-YL)PHENOL HYDROCHLORIDE, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(aminomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenol;hydrochloride (CAS 2411635-80-6) is a chemical compound with the molecular formula C11H13ClN2OS and a molecular weight of 256.75 g/mol. IUPAC name: 2-(aminomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenol;hydrochloride. InChIKey: AYHIZBDKZLOQEN-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2OS |
|---|---|
| Molecular weight | 256.75 g/mol |
| IUPAC name | 2-(aminomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenol;hydrochloride |
| InChIKey | AYHIZBDKZLOQEN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C2=CC(=C(C=C2)CN)O.Cl |
Computed by PubChem (NCBI)