CAS 1797133-98-2 is the registry number for (2R)-Avibactam Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
Sodium [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CAS 1797133-98-2) is a chemical compound with the molecular formula C7H10N3NaO6S and a molecular weight of 287.23 g/mol. IUPAC name: sodium [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate. InChIKey: RTCIKUMODPANKX-TYSVMGFPSA-M.
| Molecular formula | C7H10N3NaO6S |
|---|---|
| Molecular weight | 287.23 g/mol |
| IUPAC name | sodium [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| InChIKey | RTCIKUMODPANKX-TYSVMGFPSA-M |
| SMILES | C1C[C@@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+] |
Computed by PubChem (NCBI)