CAS 2064219-24-3 appears in our catalog under these names: Avibactam Impurity 13, Avibactam Impurity 63. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Sodium [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CAS 2064219-24-3) is a chemical compound with the molecular formula C7H10N3NaO6S and a molecular weight of 287.23 g/mol. IUPAC name: sodium [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate. InChIKey: RTCIKUMODPANKX-TYSVMGFPSA-M.
| Molecular formula | C7H10N3NaO6S |
|---|---|
| Molecular weight | 287.23 g/mol |
| IUPAC name | sodium [(2R,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| InChIKey | RTCIKUMODPANKX-TYSVMGFPSA-M |
| SMILES | C1C[C@@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+] |
Computed by PubChem (NCBI)