CAS 2064219-26-5 appears in our catalog under these names: Sodium (1S,2S,5S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl sulfate, 95%, (2S,5S)-Avibactam Sodium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
Sodium [(2S,5S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CAS 2064219-26-5) is a chemical compound with the molecular formula C7H10N3NaO6S and a molecular weight of 287.23 g/mol. IUPAC name: sodium [(2S,5S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate. InChIKey: RTCIKUMODPANKX-FHAQVOQBSA-M.
| Molecular formula | C7H10N3NaO6S |
|---|---|
| Molecular weight | 287.23 g/mol |
| IUPAC name | sodium [(2S,5S)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| InChIKey | RTCIKUMODPANKX-FHAQVOQBSA-M |
| SMILES | C1C[C@H](N2C[C@H]1N(C2=O)OS(=O)(=O)[O-])C(=O)N.[Na+] |
Computed by PubChem (NCBI)