Products 179749-59-8
CAS 179749-59-8 is the registry number for Tulobuterol Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,2-dibromo-1-(2-chlorophenyl)ethanol (CAS 179749-59-8) is a chemical compound with the molecular formula C8H7Br2ClO and a molecular weight of 314.40 g/mol. IUPAC name: 2,2-dibromo-1-(2-chlorophenyl)ethanol. InChIKey: UZOSELVKYSJIDA-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2ClO |
|---|---|
| Molecular weight | 314.40 g/mol |
| IUPAC name | 2,2-dibromo-1-(2-chlorophenyl)ethanol |
| InChIKey | UZOSELVKYSJIDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(Br)Br)O)Cl |
Computed by PubChem (NCBI)