Products 281678-66-8
CAS 281678-66-8 is the registry number for 1,3-Dibromo-2-(2-chloroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1,3-dibromo-2-(2-chloroethoxy)benzene (CAS 281678-66-8) is a chemical compound with the molecular formula C8H7Br2ClO and a molecular weight of 314.40 g/mol. IUPAC name: 1,3-dibromo-2-(2-chloroethoxy)benzene. InChIKey: ZQAOIFYSBQZPRD-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2ClO |
|---|---|
| Molecular weight | 314.40 g/mol |
| IUPAC name | 1,3-dibromo-2-(2-chloroethoxy)benzene |
| InChIKey | ZQAOIFYSBQZPRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OCCCl)Br |
Computed by PubChem (NCBI)