Products 876486-37-2

CAS 876486-37-2 is the registry number for 1,5-Dibromo-3-chloro-2-ethoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1,5-dibromo-3-chloro-2-ethoxybenzene (CAS 876486-37-2) is a chemical compound with the molecular formula C8H7Br2ClO and a molecular weight of 314.40 g/mol. IUPAC name: 1,5-dibromo-3-chloro-2-ethoxybenzene. InChIKey: OQMRAJYZUCEUTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7Br2ClO
Molecular weight314.40 g/mol
IUPAC name1,5-dibromo-3-chloro-2-ethoxybenzene
InChIKeyOQMRAJYZUCEUTQ-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1Br)Br)Cl

Computed by PubChem (NCBI)