CAS 1797636-14-6 appears in our catalog under these names: 1-(3-Aminophenyl)-N,N-dimethyl-1H-1,2,4-triazol-3-amine, 95%, 1-(3-Aminophenyl)-N,N-dimethyl-1H-1,2,4-triazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3-aminophenyl)-N,N-dimethyl-1,2,4-triazol-3-amine (CAS 1797636-14-6) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 1-(3-aminophenyl)-N,N-dimethyl-1,2,4-triazol-3-amine. InChIKey: KVDFCEKYWDVOHW-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-(3-aminophenyl)-N,N-dimethyl-1,2,4-triazol-3-amine |
| InChIKey | KVDFCEKYWDVOHW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NN(C=N1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)