CAS 17977-76-3 is the registry number for 2-Chloro-N-(4-chloro-2-((hydroxyimino)phenylmethyl)phenyl)acetamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg.
2-chloro-N-[4-chloro-2-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenyl]acetamide (CAS 17977-76-3) is a chemical compound with the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.2 g/mol. IUPAC name: 2-chloro-N-[4-chloro-2-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenyl]acetamide. InChIKey: JGFXVLJITZQQDW-XDJHFCHBSA-N.
| Molecular formula | C15H12Cl2N2O2 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 2-chloro-N-[4-chloro-2-[(E)-N-hydroxy-C-phenylcarbonimidoyl]phenyl]acetamide |
| InChIKey | JGFXVLJITZQQDW-XDJHFCHBSA-N |
| SMILES | C1=CC=C(C=C1)/C(=N\O)/C2=C(C=CC(=C2)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)