Products 891738-32-2
CAS 891738-32-2 is the registry number for 6,8-Dichloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine (CAS 891738-32-2) is a chemical compound with the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.2 g/mol. IUPAC name: 6,8-dichloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine. InChIKey: MCIVBOCORRFZLJ-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N2O2 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 6,8-dichloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine |
| InChIKey | MCIVBOCORRFZLJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CN3C=C(C=C(C3=N2)Cl)Cl)OC |
Computed by PubChem (NCBI)