Products 18871-31-3
CAS 18871-31-3 appears in our catalog under these names: 2-[(Chloroacetyl)amino]-n-(4-chlorophenyl)benzamide, 95%, 2-(2-Chloroacetamido)-N-(4-chlorophenyl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2-chloroacetyl)amino]-N-(4-chlorophenyl)benzamide (CAS 18871-31-3) is a chemical compound with the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.2 g/mol. IUPAC name: 2-[(2-chloroacetyl)amino]-N-(4-chlorophenyl)benzamide. InChIKey: XQHYCOJRNAZHKE-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N2O2 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 2-[(2-chloroacetyl)amino]-N-(4-chlorophenyl)benzamide |
| InChIKey | XQHYCOJRNAZHKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)