Products 1797911-07-9
CAS 1797911-07-9 appears in our catalog under these names: 3–Methylbuphedrone (hydrochloride), 3-Methylbuphedrone (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 50mg, 5 mg, 50 mg, 25 mg, 10 mg.
2-(methylamino)-1-(3-methylphenyl)butan-1-one;hydrochloride (CAS 1797911-07-9) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 2-(methylamino)-1-(3-methylphenyl)butan-1-one;hydrochloride. InChIKey: ZICNURAKFHTJJS-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 2-(methylamino)-1-(3-methylphenyl)butan-1-one;hydrochloride |
| InChIKey | ZICNURAKFHTJJS-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=CC=CC(=C1)C)NC.Cl |
Computed by PubChem (NCBI)