Products 1797981-99-7
CAS 1797981-99-7 appears in our catalog under these names: 2,3-Dimethylmethcathinone hydrochloride, 2,3-DMMC (hydrochloride). Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 10 mg, 25 mg, 5 mg, 50 mg.
1-(2,3-dimethylphenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 1797981-99-7) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 1-(2,3-dimethylphenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: PMNLQHGIZPYGAB-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 1-(2,3-dimethylphenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | PMNLQHGIZPYGAB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)C(C)NC)C.Cl |
Computed by PubChem (NCBI)