Products 1797982-47-8
CAS 1797982-47-8 is the registry number for 2-((4-Benzylphenoxy)methyl)pyrido(3,4-d)pyrimidin-4(3H)-one. Offered by: TRC. Available pack sizes: 1g.
2-[(4-benzylphenoxy)methyl]-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 1797982-47-8) is a chemical compound with the molecular formula C21H17N3O2 and a molecular weight of 343.4 g/mol. IUPAC name: 2-[(4-benzylphenoxy)methyl]-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: PCCLYQSIGXLLDE-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 2-[(4-benzylphenoxy)methyl]-3H-pyrido[3,4-d]pyrimidin-4-one |
| InChIKey | PCCLYQSIGXLLDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)OCC3=NC4=C(C=CN=C4)C(=O)N3 |
Computed by PubChem (NCBI)