Products 895764-31-5
CAS 895764-31-5 is the registry number for 5,7-Diphenyl-pyrazolo(1,5-a)pyrimidine-3-carboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 1g.
Ethyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS 895764-31-5) is a chemical compound with the molecular formula C21H17N3O2 and a molecular weight of 343.4 g/mol. IUPAC name: ethyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-3-carboxylate. InChIKey: VPVGNODMXRSGGB-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | ethyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-3-carboxylate |
| InChIKey | VPVGNODMXRSGGB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2N=C(C=C(N2N=C1)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)