Products 931585-29-4
CAS 931585-29-4 is the registry number for 3-(3-Methylbenzyl)-1-phenylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-[(3-methylphenyl)methyl]-1-phenylpyrido[2,3-d]pyrimidine-2,4-dione (CAS 931585-29-4) is a chemical compound with the molecular formula C21H17N3O2 and a molecular weight of 343.4 g/mol. IUPAC name: 3-[(3-methylphenyl)methyl]-1-phenylpyrido[2,3-d]pyrimidine-2,4-dione. InChIKey: GJFXCUJFOJYVHQ-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 3-[(3-methylphenyl)methyl]-1-phenylpyrido[2,3-d]pyrimidine-2,4-dione |
| InChIKey | GJFXCUJFOJYVHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C(=O)C3=C(N=CC=C3)N(C2=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)