Products 1798723-65-5
CAS 1798723-65-5 is the registry number for 2-N,2-N-Dimethyl-1H-1,3-benzodiazole-2,5-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-N,2-N-dimethyl-3H-benzimidazole-2,5-diamine;dihydrochloride (CAS 1798723-65-5) is a chemical compound with the molecular formula C9H14Cl2N4 and a molecular weight of 249.14 g/mol. IUPAC name: 2-N,2-N-dimethyl-3H-benzimidazole-2,5-diamine;dihydrochloride. InChIKey: AQEYYFUWKMLDSO-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N4 |
|---|---|
| Molecular weight | 249.14 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-3H-benzimidazole-2,5-diamine;dihydrochloride |
| InChIKey | AQEYYFUWKMLDSO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(N1)C=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)