CAS 1823607-31-3 is the registry number for 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-trien-5-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-amine;dihydrochloride (CAS 1823607-31-3) is a chemical compound with the molecular formula C9H14Cl2N4 and a molecular weight of 249.14 g/mol. IUPAC name: 4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-amine;dihydrochloride. InChIKey: WKWGZEFUEVQNQJ-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N4 |
|---|---|
| Molecular weight | 249.14 g/mol |
| IUPAC name | 4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-amine;dihydrochloride |
| InChIKey | WKWGZEFUEVQNQJ-UHFFFAOYSA-N |
| SMILES | C1CC2C3=CN=C(N=C3CC1N2)N.Cl.Cl |
Computed by PubChem (NCBI)