CAS 1909308-48-0 appears in our catalog under these names: 1,3,6-Trimethyl-1H-pyrazolo(3,4-b)pyridin-5-amine dihydrochloride, 1,3,6-Trimethyl-1H-pyrazolo[3,4-b]pyridin-5-amine dihydrochloride, 95%, 95%, 1,3,6-Trimethyl-1H-pyrazolo[3,4-b]pyridin-5-amine dihydrochloride, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
1,3,6-trimethylpyrazolo[3,4-b]pyridin-5-amine;dihydrochloride (CAS 1909308-48-0) is a chemical compound with the molecular formula C9H14Cl2N4 and a molecular weight of 249.14 g/mol. IUPAC name: 1,3,6-trimethylpyrazolo[3,4-b]pyridin-5-amine;dihydrochloride. InChIKey: LOSIKQMKPMJEPZ-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N4 |
|---|---|
| Molecular weight | 249.14 g/mol |
| IUPAC name | 1,3,6-trimethylpyrazolo[3,4-b]pyridin-5-amine;dihydrochloride |
| InChIKey | LOSIKQMKPMJEPZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=NN(C2=N1)C)C)N.Cl.Cl |
Computed by PubChem (NCBI)