CAS 1798793-68-6 is the registry number for tert-Butyl 5-amino-8-bromo-1,3,4,5-tetrahydro-2H-benzo[c]azepine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5-amino-8-bromo-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate (CAS 1798793-68-6) is a chemical compound with the molecular formula C15H21BrN2O2 and a molecular weight of 341.24 g/mol. IUPAC name: tert-butyl 5-amino-8-bromo-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate. InChIKey: SAKFFJXGURPOAG-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O2 |
|---|---|
| Molecular weight | 341.24 g/mol |
| IUPAC name | tert-butyl 5-amino-8-bromo-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
| InChIKey | SAKFFJXGURPOAG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2=C(C1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)